C12H11NY-2 — CID 59824332
4-methyl-3-phenyl-2,3-dihydropyridin-2-ide;yttrium (PubChem CID 59824332) has the molecular formula C12H11NY-2 and a molecular weight of 258.13 g/mol. Its IUPAC name is 4-methyl-3-phenyl-2,3-dihydropyridin-2-ide;yttrium.
| Compound Name | 4-methyl-3-phenyl-2,3-dihydropyridin-2-ide;yttrium |
|---|---|
| PubChem CID | 59824332 |
| Molecular Formula | C12H11NY-2 |
| Molecular Weight | 258.13 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | 4-methyl-3-phenyl-2,3-dihydropyridin-2-ide;yttrium |
| SMILES | CC1=CC=N[CH-]C1c1[c-]cccc1.[Y] |
| InChI | InChI=1S/C12H11N.Y/c1-10-7-8-13-9-12(10)11-5-3-2-4-6-11;/h2-5,7-9,12H,1H3;/q-2; |
| InChIKey | TXJNIVLEAZIDHA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.13 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|