C11H15N — CID 123975726
5-ethyl-4-methyl-3a,7a-dihydro-3H-indole (PubChem CID 123975726) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 5-ethyl-4-methyl-3a,7a-dihydro-3H-indole.
| Compound Name | 5-ethyl-4-methyl-3a,7a-dihydro-3H-indole |
|---|---|
| PubChem CID | 123975726 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 5-ethyl-4-methyl-3a,7a-dihydro-3H-indole |
| SMILES | CCC1=C(C)C2CC=NC2C=C1 |
| InChI | InChI=1S/C11H15N/c1-3-9-4-5-11-10(8(9)2)6-7-12-11/h4-5,7,10-11H,3,6H2,1-2H3 |
| InChIKey | VCQGBBXBZFWNGU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |