C11H13N — CID 91496086
3-propylidene-3a,7a-dihydroindole (PubChem CID 91496086) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is 3-propylidene-3a,7a-dihydroindole.
| Compound Name | 3-propylidene-3a,7a-dihydroindole |
|---|---|
| PubChem CID | 91496086 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 3-propylidene-3a,7a-dihydroindole |
| SMILES | CCC=C1C=NC2C=CC=CC12 |
| InChI | InChI=1S/C11H13N/c1-2-5-9-8-12-11-7-4-3-6-10(9)11/h3-8,10-11H,2H2,1H3 |
| InChIKey | AGWYYXKVOGVURR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |