C10H11N — CID 57240057
3-azabicyclo[5.2.2]undeca-1(9),3,5,7-tetraene (PubChem CID 57240057) has the molecular formula C10H11N and a molecular weight of 145.20 g/mol. Its IUPAC name is 3-azabicyclo[5.2.2]undeca-1(9),3,5,7-tetraene.
| Compound Name | 3-azabicyclo[5.2.2]undeca-1(9),3,5,7-tetraene |
|---|---|
| PubChem CID | 57240057 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 3-azabicyclo[5.2.2]undeca-1(9),3,5,7-tetraene |
| SMILES | C1=CC2=CC=C(CC2)C/N=C\1 |
| InChI | InChI=1S/C10H11N/c1-2-9-3-5-10(6-4-9)8-11-7-1/h1-3,5,7H,4,6,8H2/b2-1?,11-7- |
| InChIKey | KJAUUOXYLHKUMV-YPKGETMISA-N |
| XLogP | 2.27 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |