C11H9NO5S — CID 54010039
5-(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)-2-methoxybenzoic acid (PubChem CID 54010039) has the molecular formula C11H9NO5S and a molecular weight of 267.26 g/mol. Its IUPAC name is 5-(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)-2-methoxybenzoic acid.
| Compound Name | 5-(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 54010039 |
| Molecular Formula | C11H9NO5S |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | 5-(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)-2-methoxybenzoic acid |
| SMILES | COc1ccc(-c2sc(=O)[nH]c2O)cc1C(=O)O |
| InChI | InChI=1S/C11H9NO5S/c1-17-7-3-2-5(4-6(7)10(14)15)8-9(13)12-11(16)18-8/h2-4,13H,1H3,(H,12,16)(H,14,15) |
| InChIKey | KRRDCXIGKPQNGL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |