C20H21N5O5 — CID 154661991
5-[4-(5-amino-4-hydrazinyl-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]-2-methoxybenzoic acid (PubChem CID 154661991) has the molecular formula C20H21N5O5 and a molecular weight of 411.42 g/mol. Its IUPAC name is 5-[4-(5-amino-4-hydrazinyl-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]-2-methoxybenzoic acid.
| Compound Name | 5-[4-(5-amino-4-hydrazinyl-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 154661991 |
| Molecular Formula | C20H21N5O5 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 5-[4-(5-amino-4-hydrazinyl-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]-2-methoxybenzoic acid |
| SMILES | CCOc1cc(-c2ccc(OC)c(C(=O)O)c2)ccc1-c1nc(NN)c(N)c(=O)[nH]1 |
| InChI | InChI=1S/C20H21N5O5/c1-3-30-15-9-11(10-5-7-14(29-2)13(8-10)20(27)28)4-6-12(15)17-23-18(25-22)16(21)19(26)24-17/h4-9H,3,21-22H2,1-2H3,(H,27,28)(H2,23,24,25,26) |
| InChIKey | CSPGNXUCERMPPZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 165.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|