C25H31N5O5 — CID 154661840
ethyl 2-[3-[4-(5-amino-4-hydrazinyl-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]phenoxy]-3-methylbutanoate (PubChem CID 154661840) has the molecular formula C25H31N5O5 and a molecular weight of 481.55 g/mol. Its IUPAC name is ethyl 2-[3-[4-(5-amino-4-hydrazinyl-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]phenoxy]-3-methylbutanoate.
| Compound Name | ethyl 2-[3-[4-(5-amino-4-hydrazinyl-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]phenoxy]-3-methylbutanoate |
|---|---|
| PubChem CID | 154661840 |
| Molecular Formula | C25H31N5O5 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | ethyl 2-[3-[4-(5-amino-4-hydrazinyl-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]phenoxy]-3-methylbutanoate |
| SMILES | CCOC(=O)C(Oc1cccc(-c2ccc(-c3nc(NN)c(N)c(=O)[nH]3)c(OCC)c2)c1)C(C)C |
| InChI | InChI=1S/C25H31N5O5/c1-5-33-19-13-16(10-11-18(19)22-28-23(30-27)20(26)24(31)29-22)15-8-7-9-17(12-15)35-21(14(3)4)25(32)34-6-2/h7-14,21H,5-6,26-27H2,1-4H3,(H2,28,29,30,31) |
| InChIKey | JOXPQFVVXJEUIJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 154.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|