C17H17N5O4S — CID 154661789
5-[4-(5-amino-4-hydrazinyl-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]thiophene-2-carboxylic acid (PubChem CID 154661789) has the molecular formula C17H17N5O4S and a molecular weight of 387.42 g/mol. Its IUPAC name is 5-[4-(5-amino-4-hydrazinyl-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[4-(5-amino-4-hydrazinyl-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 154661789 |
| Molecular Formula | C17H17N5O4S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 5-[4-(5-amino-4-hydrazinyl-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]thiophene-2-carboxylic acid |
| SMILES | CCOc1cc(-c2ccc(C(=O)O)s2)ccc1-c1nc(NN)c(N)c(=O)[nH]1 |
| InChI | InChI=1S/C17H17N5O4S/c1-2-26-10-7-8(11-5-6-12(27-11)17(24)25)3-4-9(10)14-20-15(22-19)13(18)16(23)21-14/h3-7H,2,18-19H2,1H3,(H,24,25)(H2,20,21,22,23) |
| InChIKey | JPBHVEJITKMLAJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 156.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|