C21H21N5O7 — CID 154661951
3-[4-(5-amino-4-hydrazinyl-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]-5-(carboxymethoxy)benzoic acid (PubChem CID 154661951) has the molecular formula C21H21N5O7 and a molecular weight of 455.43 g/mol. Its IUPAC name is 3-[4-(5-amino-4-hydrazinyl-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]-5-(carboxymethoxy)benzoic acid.
| Compound Name | 3-[4-(5-amino-4-hydrazinyl-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]-5-(carboxymethoxy)benzoic acid |
|---|---|
| PubChem CID | 154661951 |
| Molecular Formula | C21H21N5O7 |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 3-[4-(5-amino-4-hydrazinyl-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]-5-(carboxymethoxy)benzoic acid |
| SMILES | CCOc1cc(-c2cc(OCC(=O)O)cc(C(=O)O)c2)ccc1-c1nc(NN)c(N)c(=O)[nH]1 |
| InChI | InChI=1S/C21H21N5O7/c1-2-32-15-8-10(3-4-14(15)18-24-19(26-23)17(22)20(29)25-18)11-5-12(21(30)31)7-13(6-11)33-9-16(27)28/h3-8H,2,9,22-23H2,1H3,(H,27,28)(H,30,31)(H2,24,25,26,29) |
| InChIKey | MPGIKCWRLPGNMB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 202.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|