C24H31N5O4 — CID 154661695
3-[3-[4-(5-amino-4-hydrazinyl-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]phenyl]-2-methylpropanoic acid;ethane (PubChem CID 154661695) has the molecular formula C24H31N5O4 and a molecular weight of 453.54 g/mol. Its IUPAC name is 3-[3-[4-(5-amino-4-hydrazinyl-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]phenyl]-2-methylpropanoic acid;ethane.
| Compound Name | 3-[3-[4-(5-amino-4-hydrazinyl-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]phenyl]-2-methylpropanoic acid;ethane |
|---|---|
| PubChem CID | 154661695 |
| Molecular Formula | C24H31N5O4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 3-[3-[4-(5-amino-4-hydrazinyl-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]phenyl]-2-methylpropanoic acid;ethane |
| SMILES | CC.CCOc1cc(-c2cccc(CC(C)C(=O)O)c2)ccc1-c1nc(NN)c(N)c(=O)[nH]1 |
| InChI | InChI=1S/C22H25N5O4.C2H6/c1-3-31-17-11-15(14-6-4-5-13(10-14)9-12(2)22(29)30)7-8-16(17)19-25-20(27-24)18(23)21(28)26-19;1-2/h4-8,10-12H,3,9,23-24H2,1-2H3,(H,29,30)(H2,25,26,27,28);1-2H3 |
| InChIKey | LFGPPGBDMQSFOX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 156.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|