C23H27N5O4 — CID 155018040
methyl 3-[3-[4-(4-amino-5-hydrazinyl-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]phenyl]-2-methylpropanoate (PubChem CID 155018040) has the molecular formula C23H27N5O4 and a molecular weight of 437.50 g/mol. Its IUPAC name is methyl 3-[3-[4-(4-amino-5-hydrazinyl-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]phenyl]-2-methylpropanoate.
| Compound Name | methyl 3-[3-[4-(4-amino-5-hydrazinyl-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]phenyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 155018040 |
| Molecular Formula | C23H27N5O4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | methyl 3-[3-[4-(4-amino-5-hydrazinyl-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]phenyl]-2-methylpropanoate |
| SMILES | CCOc1cc(-c2cccc(CC(C)C(=O)OC)c2)ccc1-c1nc(N)c(NN)c(=O)[nH]1 |
| InChI | InChI=1S/C23H27N5O4/c1-4-32-18-12-16(15-7-5-6-14(11-15)10-13(2)23(30)31-3)8-9-17(18)21-26-20(24)19(28-25)22(29)27-21/h5-9,11-13,28H,4,10,25H2,1-3H3,(H3,24,26,27,29) |
| InChIKey | ODVLHDDDKGNVLQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|