C27H34N6O5 — CID 154661846
3-[3-[4-(5-amino-4-hydrazinyl-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]-4-(2-pyrrolidin-1-ylethoxy)phenyl]propanoic acid (PubChem CID 154661846) has the molecular formula C27H34N6O5 and a molecular weight of 522.61 g/mol. Its IUPAC name is 3-[3-[4-(5-amino-4-hydrazinyl-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]-4-(2-pyrrolidin-1-ylethoxy)phenyl]propanoic acid.
| Compound Name | 3-[3-[4-(5-amino-4-hydrazinyl-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]-4-(2-pyrrolidin-1-ylethoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 154661846 |
| Molecular Formula | C27H34N6O5 |
| Molecular Weight | 522.61 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | 3-[3-[4-(5-amino-4-hydrazinyl-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]-4-(2-pyrrolidin-1-ylethoxy)phenyl]propanoic acid |
| SMILES | CCOc1cc(-c2cc(CCC(=O)O)ccc2OCCN2CCCC2)ccc1-c1nc(NN)c(N)c(=O)[nH]1 |
| InChI | InChI=1S/C27H34N6O5/c1-2-37-22-16-18(7-8-19(22)25-30-26(32-29)24(28)27(36)31-25)20-15-17(6-10-23(34)35)5-9-21(20)38-14-13-33-11-3-4-12-33/h5,7-9,15-16H,2-4,6,10-14,28-29H2,1H3,(H,34,35)(H2,30,31,32,36) |
| InChIKey | MIHGKQGFINDBAG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 168.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.61 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|