C32H20N10O8 — CID 54012086
2,3,5,6-tetrakis[2-(6-nitro-2-pyridinyl)ethenyl]pyrazine (PubChem CID 54012086) has the molecular formula C32H20N10O8 and a molecular weight of 672.57 g/mol. Its IUPAC name is 2,3,5,6-tetrakis[2-(6-nitro-2-pyridinyl)ethenyl]pyrazine.
| Compound Name | 2,3,5,6-tetrakis[2-(6-nitro-2-pyridinyl)ethenyl]pyrazine |
|---|---|
| PubChem CID | 54012086 |
| Molecular Formula | C32H20N10O8 |
| Molecular Weight | 672.57 g/mol |
| Exact Mass | 672.15 |
| IUPAC Name | 2,3,5,6-tetrakis[2-(6-nitro-2-pyridinyl)ethenyl]pyrazine |
| SMILES | O=[N+]([O-])c1cccc(C=Cc2nc(C=Cc3cccc([N+](=O)[O-])n3)c(C=Cc3cccc([N+](=O)[O-])n3)nc2C=Cc2cccc([N+](=O)[O-])n2)n1 |
| InChI | InChI=1S/C32H20N10O8/c43-39(44)29-9-1-5-21(33-29)13-17-25-26(18-14-22-6-2-10-30(34-22)40(45)46)38-28(20-16-24-8-4-12-32(36-24)42(49)50)27(37-25)19-15-23-7-3-11-31(35-23)41(47)48/h1-20H |
| InChIKey | KTBJZELDNUUTKR-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 249.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.57 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|