C8H12N4O4 — CID 54015155
but-1-ene-1,1,2,3-tetracarboxamide (PubChem CID 54015155) has the molecular formula C8H12N4O4 and a molecular weight of 228.21 g/mol. Its IUPAC name is but-1-ene-1,1,2,3-tetracarboxamide.
| Compound Name | but-1-ene-1,1,2,3-tetracarboxamide |
|---|---|
| PubChem CID | 54015155 |
| Molecular Formula | C8H12N4O4 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | but-1-ene-1,1,2,3-tetracarboxamide |
| SMILES | CC(C(N)=O)C(C(N)=O)=C(C(N)=O)C(N)=O |
| InChI | InChI=1S/C8H12N4O4/c1-2(5(9)13)3(6(10)14)4(7(11)15)8(12)16/h2H,1H3,(H2,9,13)(H2,10,14)(H2,11,15)(H2,12,16) |
| InChIKey | KVCLIGRATZKPHQ-UHFFFAOYSA-N |
| XLogP | -3.14 |
| TPSA | 172.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|