C32H50N2O10 — CID 54016557
[8-[[4-[[5-(2-methylprop-2-enoyloxy)-3-oxooctoxy]carbonylamino]cyclohexyl]carbamoyloxy]-6-oxooctan-4-yl] 2-methylprop-2-enoate (PubChem CID 54016557) has the molecular formula C32H50N2O10 and a molecular weight of 622.76 g/mol. Its IUPAC name is [8-[[4-[[5-(2-methylprop-2-enoyloxy)-3-oxooctoxy]carbonylamino]cyclohexyl]carbamoyloxy]-6-oxooctan-4-yl] 2-methylprop-2-enoate.
| Compound Name | [8-[[4-[[5-(2-methylprop-2-enoyloxy)-3-oxooctoxy]carbonylamino]cyclohexyl]carbamoyloxy]-6-oxooctan-4-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 54016557 |
| Molecular Formula | C32H50N2O10 |
| Molecular Weight | 622.76 g/mol |
| Exact Mass | 622.35 |
| IUPAC Name | [8-[[4-[[5-(2-methylprop-2-enoyloxy)-3-oxooctoxy]carbonylamino]cyclohexyl]carbamoyloxy]-6-oxooctan-4-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CCC)CC(=O)CCOC(=O)NC1CCC(NC(=O)OCCC(=O)CC(CCC)OC(=O)C(=C)C)CC1 |
| InChI | InChI=1S/C32H50N2O10/c1-7-9-27(43-29(37)21(3)4)19-25(35)15-17-41-31(39)33-23-11-13-24(14-12-23)34-32(40)42-18-16-26(36)20-28(10-8-2)44-30(38)22(5)6/h23-24,27-28H,3,5,7-20H2,1-2,4,6H3,(H,33,39)(H,34,40) |
| InChIKey | KVZZVTFEYLLROR-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 163.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.76 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|