C31H30N2O6S — CID 54017704
N-[4-[[4-[4-[(6,7-dihydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)methoxy]phenyl]phenyl]sulfamoyl]phenyl]acetamide (PubChem CID 54017704) has the molecular formula C31H30N2O6S and a molecular weight of 558.66 g/mol. Its IUPAC name is N-[4-[[4-[4-[(6,7-dihydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)methoxy]phenyl]phenyl]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[4-[4-[(6,7-dihydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)methoxy]phenyl]phenyl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 54017704 |
| Molecular Formula | C31H30N2O6S |
| Molecular Weight | 558.66 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | N-[4-[[4-[4-[(6,7-dihydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)methoxy]phenyl]phenyl]sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2ccc(-c3ccc(OCC4CCCc5cc(O)c(O)cc54)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H30N2O6S/c1-20(34)32-25-11-15-28(16-12-25)40(37,38)33-26-9-5-21(6-10-26)22-7-13-27(14-8-22)39-19-24-4-2-3-23-17-30(35)31(36)18-29(23)24/h5-18,24,33,35-36H,2-4,19H2,1H3,(H,32,34) |
| InChIKey | KWSZIDULZFHKFZ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.66 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|