C29H26INO5S — CID 54023585
N-[4-[4-[(6,7-dihydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)methoxy]phenyl]phenyl]-4-iodobenzenesulfonamide (PubChem CID 54023585) has the molecular formula C29H26INO5S and a molecular weight of 627.50 g/mol. Its IUPAC name is N-[4-[4-[(6,7-dihydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)methoxy]phenyl]phenyl]-4-iodobenzenesulfonamide.
| Compound Name | N-[4-[4-[(6,7-dihydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)methoxy]phenyl]phenyl]-4-iodobenzenesulfonamide |
|---|---|
| PubChem CID | 54023585 |
| Molecular Formula | C29H26INO5S |
| Molecular Weight | 627.50 g/mol |
| Exact Mass | 627.06 |
| IUPAC Name | N-[4-[4-[(6,7-dihydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)methoxy]phenyl]phenyl]-4-iodobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(-c2ccc(OCC3CCCc4cc(O)c(O)cc43)cc2)cc1)c1ccc(I)cc1 |
| InChI | InChI=1S/C29H26INO5S/c30-23-8-14-26(15-9-23)37(34,35)31-24-10-4-19(5-11-24)20-6-12-25(13-7-20)36-18-22-3-1-2-21-16-28(32)29(33)17-27(21)22/h4-17,22,31-33H,1-3,18H2 |
| InChIKey | LAPOXTLJTIPSOB-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.50 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|