C16H34N6S — CID 54018547
1-[3-(diethylamino)propyl]-3-[N'-(2-piperidin-1-ylethyl)carbamimidoyl]thiourea (PubChem CID 54018547) has the molecular formula C16H34N6S and a molecular weight of 342.56 g/mol. Its IUPAC name is 1-[3-(diethylamino)propyl]-3-[N'-(2-piperidin-1-ylethyl)carbamimidoyl]thiourea.
| Compound Name | 1-[3-(diethylamino)propyl]-3-[N'-(2-piperidin-1-ylethyl)carbamimidoyl]thiourea |
|---|---|
| PubChem CID | 54018547 |
| Molecular Formula | C16H34N6S |
| Molecular Weight | 342.56 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | 1-[3-(diethylamino)propyl]-3-[N'-(2-piperidin-1-ylethyl)carbamimidoyl]thiourea |
| SMILES | CCN(CC)CCCNC(=S)N/C(N)=N/CCN1CCCCC1 |
| InChI | InChI=1S/C16H34N6S/c1-3-21(4-2)13-8-9-19-16(23)20-15(17)18-10-14-22-11-6-5-7-12-22/h3-14H2,1-2H3,(H4,17,18,19,20,23) |
| InChIKey | KXHRALRWDDTICQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.56 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|