C11H19N3O4 — CID 54020554
[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl] 1-aminocyclobutane-1-carboxylate (PubChem CID 54020554) has the molecular formula C11H19N3O4 and a molecular weight of 257.29 g/mol. Its IUPAC name is [(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl] 1-aminocyclobutane-1-carboxylate.
| Compound Name | [(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl] 1-aminocyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 54020554 |
| Molecular Formula | C11H19N3O4 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | [(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl] 1-aminocyclobutane-1-carboxylate |
| SMILES | C[C@H](N)C(=O)N[C@@H](C)C(=O)OC(=O)C1(N)CCC1 |
| InChI | InChI=1S/C11H19N3O4/c1-6(12)8(15)14-7(2)9(16)18-10(17)11(13)4-3-5-11/h6-7H,3-5,12-13H2,1-2H3,(H,14,15)/t6-,7-/m0/s1 |
| InChIKey | KYQDHOKHDFNWTI-BQBZGAKWSA-N |
| XLogP | -1.21 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|