C24H30N4O3 — CID 54024890
tert-butyl N-[amino-[4-[(2-ethyl-3,4-dihydro-1H-isoquinolin-6-yl)carbamoyl]phenyl]methylidene]carbamate (PubChem CID 54024890) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is tert-butyl N-[amino-[4-[(2-ethyl-3,4-dihydro-1H-isoquinolin-6-yl)carbamoyl]phenyl]methylidene]carbamate.
| Compound Name | tert-butyl N-[amino-[4-[(2-ethyl-3,4-dihydro-1H-isoquinolin-6-yl)carbamoyl]phenyl]methylidene]carbamate |
|---|---|
| PubChem CID | 54024890 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | tert-butyl N-[amino-[4-[(2-ethyl-3,4-dihydro-1H-isoquinolin-6-yl)carbamoyl]phenyl]methylidene]carbamate |
| SMILES | CCN1CCc2cc(NC(=O)c3ccc(C(N)=NC(=O)OC(C)(C)C)cc3)ccc2C1 |
| InChI | InChI=1S/C24H30N4O3/c1-5-28-13-12-18-14-20(11-10-19(18)15-28)26-22(29)17-8-6-16(7-9-17)21(25)27-23(30)31-24(2,3)4/h6-11,14H,5,12-13,15H2,1-4H3,(H,26,29)(H2,25,27,30) |
| InChIKey | LBMKHRKNDYNJTO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|