C21H34O — CID 54026402
(1R,2S,4R,6S,7S,10S,11S)-6-ethyl-7,11-dimethyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadecane (PubChem CID 54026402) has the molecular formula C21H34O and a molecular weight of 302.50 g/mol. Its IUPAC name is (1R,2S,4R,6S,7S,10S,11S)-6-ethyl-7,11-dimethyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadecane.
| Compound Name | (1R,2S,4R,6S,7S,10S,11S)-6-ethyl-7,11-dimethyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadecane |
|---|---|
| PubChem CID | 54026402 |
| Molecular Formula | C21H34O |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | (1R,2S,4R,6S,7S,10S,11S)-6-ethyl-7,11-dimethyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadecane |
| SMILES | CC[C@@]12O[C@@H]1C[C@H]1[C@@H]3CCC4CCCC[C@]4(C)[C@H]3CC[C@@]12C |
| InChI | InChI=1S/C21H34O/c1-4-21-18(22-21)13-17-15-9-8-14-7-5-6-11-19(14,2)16(15)10-12-20(17,21)3/h14-18H,4-13H2,1-3H3/t14?,15-,16+,17+,18-,19+,20+,21-/m1/s1 |
| InChIKey | LCMJZDAWLUULJG-WGTNYMMVSA-N |
| XLogP | 5.58 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|