C29H28O6 — CID 54027984
5-[4-[(4-benzoyl-3-hydroxy-2-prop-2-enylphenyl)methoxy]phenyl]-3-methyl-5-oxopentanoic acid (PubChem CID 54027984) has the molecular formula C29H28O6 and a molecular weight of 472.54 g/mol. Its IUPAC name is 5-[4-[(4-benzoyl-3-hydroxy-2-prop-2-enylphenyl)methoxy]phenyl]-3-methyl-5-oxopentanoic acid.
| Compound Name | 5-[4-[(4-benzoyl-3-hydroxy-2-prop-2-enylphenyl)methoxy]phenyl]-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 54027984 |
| Molecular Formula | C29H28O6 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 5-[4-[(4-benzoyl-3-hydroxy-2-prop-2-enylphenyl)methoxy]phenyl]-3-methyl-5-oxopentanoic acid |
| SMILES | C=CCc1c(COc2ccc(C(=O)CC(C)CC(=O)O)cc2)ccc(C(=O)c2ccccc2)c1O |
| InChI | InChI=1S/C29H28O6/c1-3-7-24-22(12-15-25(29(24)34)28(33)21-8-5-4-6-9-21)18-35-23-13-10-20(11-14-23)26(30)16-19(2)17-27(31)32/h3-6,8-15,19,34H,1,7,16-18H2,2H3,(H,31,32) |
| InChIKey | LDOYCJKYAFZMMA-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|