C16H13N5S2 — CID 54029276
2-imidazol-1-yl-N-methyl-N,5-dithiophen-2-ylpyrimidin-4-amine (PubChem CID 54029276) has the molecular formula C16H13N5S2 and a molecular weight of 339.45 g/mol. Its IUPAC name is 2-imidazol-1-yl-N-methyl-N,5-dithiophen-2-ylpyrimidin-4-amine.
| Compound Name | 2-imidazol-1-yl-N-methyl-N,5-dithiophen-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 54029276 |
| Molecular Formula | C16H13N5S2 |
| Molecular Weight | 339.45 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 2-imidazol-1-yl-N-methyl-N,5-dithiophen-2-ylpyrimidin-4-amine |
| SMILES | CN(c1cccs1)c1nc(-n2ccnc2)ncc1-c1cccs1 |
| InChI | InChI=1S/C16H13N5S2/c1-20(14-5-3-9-23-14)15-12(13-4-2-8-22-13)10-18-16(19-15)21-7-6-17-11-21/h2-11H,1H3 |
| InChIKey | LEKNJIBONNCUAG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |