C14H18N6S2 — CID 11537324
N'-(3-imidazol-1-yl-1,2,4-thiadiazol-5-yl)-N'-methyl-N-(thiophen-2-ylmethyl)propane-1,3-diamine (PubChem CID 11537324) has the molecular formula C14H18N6S2 and a molecular weight of 334.47 g/mol. Its IUPAC name is N'-(3-imidazol-1-yl-1,2,4-thiadiazol-5-yl)-N'-methyl-N-(thiophen-2-ylmethyl)propane-1,3-diamine.
| Compound Name | N'-(3-imidazol-1-yl-1,2,4-thiadiazol-5-yl)-N'-methyl-N-(thiophen-2-ylmethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 11537324 |
| Molecular Formula | C14H18N6S2 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | N'-(3-imidazol-1-yl-1,2,4-thiadiazol-5-yl)-N'-methyl-N-(thiophen-2-ylmethyl)propane-1,3-diamine |
| SMILES | CN(CCCNCc1cccs1)c1nc(-n2ccnc2)ns1 |
| InChI | InChI=1S/C14H18N6S2/c1-19(7-3-5-15-10-12-4-2-9-21-12)14-17-13(18-22-14)20-8-6-16-11-20/h2,4,6,8-9,11,15H,3,5,7,10H2,1H3 |
| InChIKey | ZLTVNDRYTQJURG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|