C14H21N3S2 — CID 79494518
N-methyl-4-(propylaminomethyl)-N-(2-thiophen-2-ylethyl)-1,3-thiazol-2-amine (PubChem CID 79494518) has the molecular formula C14H21N3S2 and a molecular weight of 295.48 g/mol. Its IUPAC name is N-methyl-4-(propylaminomethyl)-N-(2-thiophen-2-ylethyl)-1,3-thiazol-2-amine.
| Compound Name | N-methyl-4-(propylaminomethyl)-N-(2-thiophen-2-ylethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79494518 |
| Molecular Formula | C14H21N3S2 |
| Molecular Weight | 295.48 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | N-methyl-4-(propylaminomethyl)-N-(2-thiophen-2-ylethyl)-1,3-thiazol-2-amine |
| SMILES | CCCNCc1csc(N(C)CCc2cccs2)n1 |
| InChI | InChI=1S/C14H21N3S2/c1-3-7-15-10-12-11-19-14(16-12)17(2)8-6-13-5-4-9-18-13/h4-5,9,11,15H,3,6-8,10H2,1-2H3 |
| InChIKey | NDHKDZNDWLCATJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|