C15H17N5O2S — CID 67619633
2-[2-(6-amino-2-imidazol-1-yl-5-thiophen-2-ylpyrimidin-4-yl)ethoxy]ethanol (PubChem CID 67619633) has the molecular formula C15H17N5O2S and a molecular weight of 331.40 g/mol. Its IUPAC name is 2-[2-(6-amino-2-imidazol-1-yl-5-thiophen-2-ylpyrimidin-4-yl)ethoxy]ethanol.
| Compound Name | 2-[2-(6-amino-2-imidazol-1-yl-5-thiophen-2-ylpyrimidin-4-yl)ethoxy]ethanol |
|---|---|
| PubChem CID | 67619633 |
| Molecular Formula | C15H17N5O2S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 2-[2-(6-amino-2-imidazol-1-yl-5-thiophen-2-ylpyrimidin-4-yl)ethoxy]ethanol |
| SMILES | Nc1nc(-n2ccnc2)nc(CCOCCO)c1-c1cccs1 |
| InChI | InChI=1S/C15H17N5O2S/c16-14-13(12-2-1-9-23-12)11(3-7-22-8-6-21)18-15(19-14)20-5-4-17-10-20/h1-2,4-5,9-10,21H,3,6-8H2,(H2,16,18,19) |
| InChIKey | KIENUZLCJVIMNJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|