C17H19N5O4 — CID 70144174
methyl 5-amino-4-[2-(2-hydroxyethoxy)ethyl]-2-imidazol-1-ylquinazoline-6-carboxylate (PubChem CID 70144174) has the molecular formula C17H19N5O4 and a molecular weight of 357.37 g/mol. Its IUPAC name is methyl 5-amino-4-[2-(2-hydroxyethoxy)ethyl]-2-imidazol-1-ylquinazoline-6-carboxylate.
| Compound Name | methyl 5-amino-4-[2-(2-hydroxyethoxy)ethyl]-2-imidazol-1-ylquinazoline-6-carboxylate |
|---|---|
| PubChem CID | 70144174 |
| Molecular Formula | C17H19N5O4 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | methyl 5-amino-4-[2-(2-hydroxyethoxy)ethyl]-2-imidazol-1-ylquinazoline-6-carboxylate |
| SMILES | COC(=O)c1ccc2nc(-n3ccnc3)nc(CCOCCO)c2c1N |
| InChI | InChI=1S/C17H19N5O4/c1-25-16(24)11-2-3-12-14(15(11)18)13(4-8-26-9-7-23)21-17(20-12)22-6-5-19-10-22/h2-3,5-6,10,23H,4,7-9,18H2,1H3 |
| InChIKey | NUINDQNCOSLQNC-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|