C16H19N5O2 — CID 151921849
2-[2-(5-amino-2-imidazol-1-yl-6-methylquinazolin-4-yl)ethoxy]ethanol (PubChem CID 151921849) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 2-[2-(5-amino-2-imidazol-1-yl-6-methylquinazolin-4-yl)ethoxy]ethanol.
| Compound Name | 2-[2-(5-amino-2-imidazol-1-yl-6-methylquinazolin-4-yl)ethoxy]ethanol |
|---|---|
| PubChem CID | 151921849 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 2-[2-(5-amino-2-imidazol-1-yl-6-methylquinazolin-4-yl)ethoxy]ethanol |
| SMILES | Cc1ccc2nc(-n3ccnc3)nc(CCOCCO)c2c1N |
| InChI | InChI=1S/C16H19N5O2/c1-11-2-3-12-14(15(11)17)13(4-8-23-9-7-22)20-16(19-12)21-6-5-18-10-21/h2-3,5-6,10,22H,4,7-9,17H2,1H3 |
| InChIKey | SWXUPSVELKIXAI-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|