C21H23N2O3+ — CID 54033420
tert-butyl 2-(2-oxo-5-phenyl-3H-1,2-benzodiazepin-2-ium-1-yl)acetate (PubChem CID 54033420) has the molecular formula C21H23N2O3+ and a molecular weight of 351.43 g/mol. Its IUPAC name is tert-butyl 2-(2-oxo-5-phenyl-3H-1,2-benzodiazepin-2-ium-1-yl)acetate.
| Compound Name | tert-butyl 2-(2-oxo-5-phenyl-3H-1,2-benzodiazepin-2-ium-1-yl)acetate |
|---|---|
| PubChem CID | 54033420 |
| Molecular Formula | C21H23N2O3+ |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | tert-butyl 2-(2-oxo-5-phenyl-3H-1,2-benzodiazepin-2-ium-1-yl)acetate |
| SMILES | CC(C)(C)OC(=O)CN1c2ccccc2C(c2ccccc2)=CC[N+]1=O |
| InChI | InChI=1S/C21H23N2O3/c1-21(2,3)26-20(24)15-22-19-12-8-7-11-18(19)17(13-14-23(22)25)16-9-5-4-6-10-16/h4-13H,14-15H2,1-3H3/q+1 |
| InChIKey | OPNBWEKZSGPWQE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|