C15H16N2O2S — CID 54037813
2-[2-sulfanylidene-3-(1,2,3,4-tetrahydronaphthalen-2-yl)imidazol-1-yl]acetic acid (PubChem CID 54037813) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is 2-[2-sulfanylidene-3-(1,2,3,4-tetrahydronaphthalen-2-yl)imidazol-1-yl]acetic acid.
| Compound Name | 2-[2-sulfanylidene-3-(1,2,3,4-tetrahydronaphthalen-2-yl)imidazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 54037813 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 2-[2-sulfanylidene-3-(1,2,3,4-tetrahydronaphthalen-2-yl)imidazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1ccn(C2CCc3ccccc3C2)c1=S |
| InChI | InChI=1S/C15H16N2O2S/c18-14(19)10-16-7-8-17(15(16)20)13-6-5-11-3-1-2-4-12(11)9-13/h1-4,7-8,13H,5-6,9-10H2,(H,18,19) |
| InChIKey | LKFGELMGUOFBSO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 47.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|