C28H16Cl2F8O4 — CID 54038625
1,2-bis(4-chlorophenyl)-1,2-bis(2,3,5,6-tetrafluoro-4-methoxyphenyl)ethane-1,2-diol (PubChem CID 54038625) has the molecular formula C28H16Cl2F8O4 and a molecular weight of 639.32 g/mol. Its IUPAC name is 1,2-bis(4-chlorophenyl)-1,2-bis(2,3,5,6-tetrafluoro-4-methoxyphenyl)ethane-1,2-diol.
| Compound Name | 1,2-bis(4-chlorophenyl)-1,2-bis(2,3,5,6-tetrafluoro-4-methoxyphenyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 54038625 |
| Molecular Formula | C28H16Cl2F8O4 |
| Molecular Weight | 639.32 g/mol |
| Exact Mass | 638.03 |
| IUPAC Name | 1,2-bis(4-chlorophenyl)-1,2-bis(2,3,5,6-tetrafluoro-4-methoxyphenyl)ethane-1,2-diol |
| SMILES | COc1c(F)c(F)c(C(O)(c2ccc(Cl)cc2)C(O)(c2ccc(Cl)cc2)c2c(F)c(F)c(OC)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C28H16Cl2F8O4/c1-41-25-21(35)17(31)15(18(32)22(25)36)27(39,11-3-7-13(29)8-4-11)28(40,12-5-9-14(30)10-6-12)16-19(33)23(37)26(42-2)24(38)20(16)34/h3-10,39-40H,1-2H3 |
| InChIKey | LKTAOMZOWGGPEK-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.32 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|