About 2-hydroxydodecoxyboronic acid
2-hydroxydodecoxyboronic acid (PubChem CID 54040398) has the molecular formula C12H27BO4
and a molecular weight of 246.16 g/mol. Its IUPAC name is 2-hydroxydodecoxyboronic acid.
Molecular Properties
| Compound Name | 2-hydroxydodecoxyboronic acid |
| PubChem CID | 54040398 |
| Molecular Formula | C12H27BO4 |
| Molecular Weight | 246.16 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 2-hydroxydodecoxyboronic acid |
| SMILES | CCCCCCCCCCC(O)COB(O)O |
| InChI | InChI=1S/C12H27BO4/c1-2-3-4-5-6-7-8-9-10-12(14)11-17-13(15)16/h12,14-16H,2-11H2,1H3 |
| InChIKey | LLXGDTJBWMFQOK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.16 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxydodecoxyboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxydodecoxyboronic acid?
The IUPAC name of 2-hydroxydodecoxyboronic acid (CID 54040398) is 2-hydroxydodecoxyboronic acid.
What is the SMILES notation for 2-hydroxydodecoxyboronic acid?
The canonical SMILES for 2-hydroxydodecoxyboronic acid is CCCCCCCCCCC(O)COB(O)O.
What is the InChIKey of 2-hydroxydodecoxyboronic acid?
The InChIKey is LLXGDTJBWMFQOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27BO4/c1-2-3-4-5-6-7-8-9-10-12(14)11-17-13(15)16/h12,14-16H,2-11H2,1H3.
What are the key properties of 2-hydroxydodecoxyboronic acid?
2-hydroxydodecoxyboronic acid has a molecular weight of 246.16 g/mol, XLogP of 1.86, 12 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxydodecoxyboronic acid is sourced from PubChem (CID 54040398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).