C25H33N5O3S2 — CID 54042720
N-[(2S)-1-(4-ethylpiperidin-1-yl)-4-(1H-imidazol-5-ylmethylsulfanyl)-1-oxobutan-2-yl]-3-methylquinoline-8-sulfonamide (PubChem CID 54042720) has the molecular formula C25H33N5O3S2 and a molecular weight of 515.71 g/mol. Its IUPAC name is N-[(2S)-1-(4-ethylpiperidin-1-yl)-4-(1H-imidazol-5-ylmethylsulfanyl)-1-oxobutan-2-yl]-3-methylquinoline-8-sulfonamide.
| Compound Name | N-[(2S)-1-(4-ethylpiperidin-1-yl)-4-(1H-imidazol-5-ylmethylsulfanyl)-1-oxobutan-2-yl]-3-methylquinoline-8-sulfonamide |
|---|---|
| PubChem CID | 54042720 |
| Molecular Formula | C25H33N5O3S2 |
| Molecular Weight | 515.71 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | N-[(2S)-1-(4-ethylpiperidin-1-yl)-4-(1H-imidazol-5-ylmethylsulfanyl)-1-oxobutan-2-yl]-3-methylquinoline-8-sulfonamide |
| SMILES | CCC1CCN(C(=O)[C@H](CCSCc2cnc[nH]2)NS(=O)(=O)c2cccc3cc(C)cnc23)CC1 |
| InChI | InChI=1S/C25H33N5O3S2/c1-3-19-7-10-30(11-8-19)25(31)22(9-12-34-16-21-15-26-17-28-21)29-35(32,33)23-6-4-5-20-13-18(2)14-27-24(20)23/h4-6,13-15,17,19,22,29H,3,7-12,16H2,1-2H3,(H,26,28)/t22-/m0/s1 |
| InChIKey | LNLXKZIYNSHOET-QFIPXVFZSA-N |
| XLogP | 3.89 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.71 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|