C27H54N6O3 — CID 54044643
2-N,4-N,6-N-tris[4-(2-methylpropoxy)butyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 54044643) has the molecular formula C27H54N6O3 and a molecular weight of 510.77 g/mol. Its IUPAC name is 2-N,4-N,6-N-tris[4-(2-methylpropoxy)butyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N,6-N-tris[4-(2-methylpropoxy)butyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 54044643 |
| Molecular Formula | C27H54N6O3 |
| Molecular Weight | 510.77 g/mol |
| Exact Mass | 510.43 |
| IUPAC Name | 2-N,4-N,6-N-tris[4-(2-methylpropoxy)butyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CC(C)COCCCCNc1nc(NCCCCOCC(C)C)nc(NCCCCOCC(C)C)n1 |
| InChI | InChI=1S/C27H54N6O3/c1-22(2)19-34-16-10-7-13-28-25-31-26(29-14-8-11-17-35-20-23(3)4)33-27(32-25)30-15-9-12-18-36-21-24(5)6/h22-24H,7-21H2,1-6H3,(H3,28,29,30,31,32,33) |
| InChIKey | LOSCSLCHNGNITC-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.77 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|