C15H30N6O6 — CID 88505011
2-N,4-N,6-N-tris(4-hydroperoxybutyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 88505011) has the molecular formula C15H30N6O6 and a molecular weight of 390.44 g/mol. Its IUPAC name is 2-N,4-N,6-N-tris(4-hydroperoxybutyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N,6-N-tris(4-hydroperoxybutyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 88505011 |
| Molecular Formula | C15H30N6O6 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 2-N,4-N,6-N-tris(4-hydroperoxybutyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | OOCCCCNc1nc(NCCCCOO)nc(NCCCCOO)n1 |
| InChI | InChI=1S/C15H30N6O6/c22-25-10-4-1-7-16-13-19-14(17-8-2-5-11-26-23)21-15(20-13)18-9-3-6-12-27-24/h22-24H,1-12H2,(H3,16,17,18,19,20,21) |
| InChIKey | ASUDDKVZVFOYJP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 163.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|