C22H26O3 — CID 54044958
ethane;(5R)-2-methyl-5-(4-phenylbenzoyl)cyclopentane-1-carboxylic acid (PubChem CID 54044958) has the molecular formula C22H26O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is ethane;(5R)-2-methyl-5-(4-phenylbenzoyl)cyclopentane-1-carboxylic acid.
| Compound Name | ethane;(5R)-2-methyl-5-(4-phenylbenzoyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 54044958 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | ethane;(5R)-2-methyl-5-(4-phenylbenzoyl)cyclopentane-1-carboxylic acid |
| SMILES | CC.CC1CC[C@@H](C(=O)c2ccc(-c3ccccc3)cc2)C1C(=O)O |
| InChI | InChI=1S/C20H20O3.C2H6/c1-13-7-12-17(18(13)20(22)23)19(21)16-10-8-15(9-11-16)14-5-3-2-4-6-14;1-2/h2-6,8-11,13,17-18H,7,12H2,1H3,(H,22,23);1-2H3/t13?,17-,18?;/m1./s1 |
| InChIKey | LOXGTZAUCNRPSE-QOECITOCSA-N |
| XLogP | 5.31 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |