C28H22ClNO5 — CID 22472871
2-[4-(4-chlorophenyl)benzoyl]-5-[(1,3-dioxoisoindol-2-yl)methyl]cyclopentane-1-carboxylic acid (PubChem CID 22472871) has the molecular formula C28H22ClNO5 and a molecular weight of 487.94 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)benzoyl]-5-[(1,3-dioxoisoindol-2-yl)methyl]cyclopentane-1-carboxylic acid.
| Compound Name | 2-[4-(4-chlorophenyl)benzoyl]-5-[(1,3-dioxoisoindol-2-yl)methyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 22472871 |
| Molecular Formula | C28H22ClNO5 |
| Molecular Weight | 487.94 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 2-[4-(4-chlorophenyl)benzoyl]-5-[(1,3-dioxoisoindol-2-yl)methyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(c1ccc(-c2ccc(Cl)cc2)cc1)C1CCC(CN2C(=O)c3ccccc3C2=O)C1C(=O)O |
| InChI | InChI=1S/C28H22ClNO5/c29-20-12-9-17(10-13-20)16-5-7-18(8-6-16)25(31)23-14-11-19(24(23)28(34)35)15-30-26(32)21-3-1-2-4-22(21)27(30)33/h1-10,12-13,19,23-24H,11,14-15H2,(H,34,35) |
| InChIKey | BQCOJSOLSUNRMY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.94 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|