C34H31ClO6S — CID 18345248
benzyl 2-[4-(4-chlorophenyl)benzoyl]-5-[(4-methylphenyl)sulfonyloxymethyl]cyclopentane-1-carboxylate (PubChem CID 18345248) has the molecular formula C34H31ClO6S and a molecular weight of 603.14 g/mol. Its IUPAC name is benzyl 2-[4-(4-chlorophenyl)benzoyl]-5-[(4-methylphenyl)sulfonyloxymethyl]cyclopentane-1-carboxylate.
| Compound Name | benzyl 2-[4-(4-chlorophenyl)benzoyl]-5-[(4-methylphenyl)sulfonyloxymethyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 18345248 |
| Molecular Formula | C34H31ClO6S |
| Molecular Weight | 603.14 g/mol |
| Exact Mass | 602.15 |
| IUPAC Name | benzyl 2-[4-(4-chlorophenyl)benzoyl]-5-[(4-methylphenyl)sulfonyloxymethyl]cyclopentane-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CCC(C(=O)c3ccc(-c4ccc(Cl)cc4)cc3)C2C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C34H31ClO6S/c1-23-7-18-30(19-8-23)42(38,39)41-22-28-15-20-31(32(28)34(37)40-21-24-5-3-2-4-6-24)33(36)27-11-9-25(10-12-27)26-13-16-29(35)17-14-26/h2-14,16-19,28,31-32H,15,20-22H2,1H3 |
| InChIKey | MJOQHPPIZIOOKG-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.14 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|