C28H20Cl2N2O7 — CID 20790036
2-[(5-chloro-6-nitro-1,3-dioxoisoindol-2-yl)methyl]-5-[4-(4-chlorophenyl)benzoyl]cyclopentane-1-carboxylic acid (PubChem CID 20790036) has the molecular formula C28H20Cl2N2O7 and a molecular weight of 567.38 g/mol. Its IUPAC name is 2-[(5-chloro-6-nitro-1,3-dioxoisoindol-2-yl)methyl]-5-[4-(4-chlorophenyl)benzoyl]cyclopentane-1-carboxylic acid.
| Compound Name | 2-[(5-chloro-6-nitro-1,3-dioxoisoindol-2-yl)methyl]-5-[4-(4-chlorophenyl)benzoyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 20790036 |
| Molecular Formula | C28H20Cl2N2O7 |
| Molecular Weight | 567.38 g/mol |
| Exact Mass | 566.06 |
| IUPAC Name | 2-[(5-chloro-6-nitro-1,3-dioxoisoindol-2-yl)methyl]-5-[4-(4-chlorophenyl)benzoyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(c1ccc(-c2ccc(Cl)cc2)cc1)C1CCC(CN2C(=O)c3cc(Cl)c([N+](=O)[O-])cc3C2=O)C1C(=O)O |
| InChI | InChI=1S/C28H20Cl2N2O7/c29-18-8-5-15(6-9-18)14-1-3-16(4-2-14)25(33)19-10-7-17(24(19)28(36)37)13-31-26(34)20-11-22(30)23(32(38)39)12-21(20)27(31)35/h1-6,8-9,11-12,17,19,24H,7,10,13H2,(H,36,37) |
| InChIKey | PQUIYCYNPVQQHN-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 134.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.38 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|