C19H24N2O2 — CID 54045194
N-[4-(dimethylamino)phenyl]-2-hydroxy-5-(2-methylpropyl)benzamide (PubChem CID 54045194) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-2-hydroxy-5-(2-methylpropyl)benzamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-2-hydroxy-5-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 54045194 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-2-hydroxy-5-(2-methylpropyl)benzamide |
| SMILES | CC(C)Cc1ccc(O)c(C(=O)Nc2ccc(N(C)C)cc2)c1 |
| InChI | InChI=1S/C19H24N2O2/c1-13(2)11-14-5-10-18(22)17(12-14)19(23)20-15-6-8-16(9-7-15)21(3)4/h5-10,12-13,22H,11H2,1-4H3,(H,20,23) |
| InChIKey | LPBJLAYBPHEOIU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|