C16H13N3OS — CID 54046250
N-[2-[(4-pyridin-4-yl-1,3-thiazol-2-yl)methyl]phenyl]formamide (PubChem CID 54046250) has the molecular formula C16H13N3OS and a molecular weight of 295.37 g/mol. Its IUPAC name is N-[2-[(4-pyridin-4-yl-1,3-thiazol-2-yl)methyl]phenyl]formamide.
| Compound Name | N-[2-[(4-pyridin-4-yl-1,3-thiazol-2-yl)methyl]phenyl]formamide |
|---|---|
| PubChem CID | 54046250 |
| Molecular Formula | C16H13N3OS |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | N-[2-[(4-pyridin-4-yl-1,3-thiazol-2-yl)methyl]phenyl]formamide |
| SMILES | O=CNc1ccccc1Cc1nc(-c2ccncc2)cs1 |
| InChI | InChI=1S/C16H13N3OS/c20-11-18-14-4-2-1-3-13(14)9-16-19-15(10-21-16)12-5-7-17-8-6-12/h1-8,10-11H,9H2,(H,18,20) |
| InChIKey | LPUAMLIUQKRMQP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|