C18H22S2 — CID 54047328
2-[2-(2,6-dimethylphenyl)sulfanylethylsulfanyl]-1,3-dimethylbenzene (PubChem CID 54047328) has the molecular formula C18H22S2 and a molecular weight of 302.51 g/mol. Its IUPAC name is 2-[2-(2,6-dimethylphenyl)sulfanylethylsulfanyl]-1,3-dimethylbenzene.
| Compound Name | 2-[2-(2,6-dimethylphenyl)sulfanylethylsulfanyl]-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 54047328 |
| Molecular Formula | C18H22S2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 2-[2-(2,6-dimethylphenyl)sulfanylethylsulfanyl]-1,3-dimethylbenzene |
| SMILES | Cc1cccc(C)c1SCCSc1c(C)cccc1C |
| InChI | InChI=1S/C18H22S2/c1-13-7-5-8-14(2)17(13)19-11-12-20-18-15(3)9-6-10-16(18)4/h5-10H,11-12H2,1-4H3 |
| InChIKey | LQMDEZNPVSFPBQ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|