C14H24OSSi — CID 171362122
2-[(2,6-dimethylphenyl)sulfanylmethoxy]ethyl-trimethylsilane (PubChem CID 171362122) has the molecular formula C14H24OSSi and a molecular weight of 268.50 g/mol. Its IUPAC name is 2-[(2,6-dimethylphenyl)sulfanylmethoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(2,6-dimethylphenyl)sulfanylmethoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 171362122 |
| Molecular Formula | C14H24OSSi |
| Molecular Weight | 268.50 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 2-[(2,6-dimethylphenyl)sulfanylmethoxy]ethyl-trimethylsilane |
| SMILES | Cc1cccc(C)c1SCOCC[Si](C)(C)C |
| InChI | InChI=1S/C14H24OSSi/c1-12-7-6-8-13(2)14(12)16-11-15-9-10-17(3,4)5/h6-8H,9-11H2,1-5H3 |
| InChIKey | CHQXEXITYITMMW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|