C11H16OS — CID 143590837
3-(2,6-dimethylphenyl)sulfanylpropan-1-ol (PubChem CID 143590837) has the molecular formula C11H16OS and a molecular weight of 196.31 g/mol. Its IUPAC name is 3-(2,6-dimethylphenyl)sulfanylpropan-1-ol.
| Compound Name | 3-(2,6-dimethylphenyl)sulfanylpropan-1-ol |
|---|---|
| PubChem CID | 143590837 |
| Molecular Formula | C11H16OS |
| Molecular Weight | 196.31 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | 3-(2,6-dimethylphenyl)sulfanylpropan-1-ol |
| SMILES | Cc1cccc(C)c1SCCCO |
| InChI | InChI=1S/C11H16OS/c1-9-5-3-6-10(2)11(9)13-8-4-7-12/h3,5-6,12H,4,7-8H2,1-2H3 |
| InChIKey | CJFVOUMUYURDQM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|