C20H36O2Si — CID 140987625
2-[(2,6-ditert-butylphenoxy)methoxy]ethyl-trimethylsilane (PubChem CID 140987625) has the molecular formula C20H36O2Si and a molecular weight of 336.59 g/mol. Its IUPAC name is 2-[(2,6-ditert-butylphenoxy)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(2,6-ditert-butylphenoxy)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 140987625 |
| Molecular Formula | C20H36O2Si |
| Molecular Weight | 336.59 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | 2-[(2,6-ditert-butylphenoxy)methoxy]ethyl-trimethylsilane |
| SMILES | CC(C)(C)c1cccc(C(C)(C)C)c1OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C20H36O2Si/c1-19(2,3)16-11-10-12-17(20(4,5)6)18(16)22-15-21-13-14-23(7,8)9/h10-12H,13-15H2,1-9H3 |
| InChIKey | QWBXIIAQOQHYJA-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.59 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|