C17H23ClN2O2Si — CID 141340384
N-(4-chlorophenyl)-6-(2-trimethylsilylethoxymethoxy)pyridin-2-amine (PubChem CID 141340384) has the molecular formula C17H23ClN2O2Si and a molecular weight of 350.92 g/mol. Its IUPAC name is N-(4-chlorophenyl)-6-(2-trimethylsilylethoxymethoxy)pyridin-2-amine.
| Compound Name | N-(4-chlorophenyl)-6-(2-trimethylsilylethoxymethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 141340384 |
| Molecular Formula | C17H23ClN2O2Si |
| Molecular Weight | 350.92 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | N-(4-chlorophenyl)-6-(2-trimethylsilylethoxymethoxy)pyridin-2-amine |
| SMILES | C[Si](C)(C)CCOCOc1cccc(Nc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C17H23ClN2O2Si/c1-23(2,3)12-11-21-13-22-17-6-4-5-16(20-17)19-15-9-7-14(18)8-10-15/h4-10H,11-13H2,1-3H3,(H,19,20) |
| InChIKey | VCENJMNQTQOSKV-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.92 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|