C9H14N2O2 — CID 54051746
methyl 2-[(2S)-butan-2-yl]-1H-imidazole-5-carboxylate (PubChem CID 54051746) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is methyl 2-[(2S)-butan-2-yl]-1H-imidazole-5-carboxylate.
| Compound Name | methyl 2-[(2S)-butan-2-yl]-1H-imidazole-5-carboxylate |
|---|---|
| PubChem CID | 54051746 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | methyl 2-[(2S)-butan-2-yl]-1H-imidazole-5-carboxylate |
| SMILES | CC[C@H](C)c1ncc(C(=O)OC)[nH]1 |
| InChI | InChI=1S/C9H14N2O2/c1-4-6(2)8-10-5-7(11-8)9(12)13-3/h5-6H,4H2,1-3H3,(H,10,11)/t6-/m0/s1 |
| InChIKey | LTJDHXIJQLHRTF-LURJTMIESA-N |
| XLogP | 1.71 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |