C10H16N2O2S — CID 65137557
methyl 2-(2-methylpropylsulfanylmethyl)-1H-imidazole-5-carboxylate (PubChem CID 65137557) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is methyl 2-(2-methylpropylsulfanylmethyl)-1H-imidazole-5-carboxylate.
| Compound Name | methyl 2-(2-methylpropylsulfanylmethyl)-1H-imidazole-5-carboxylate |
|---|---|
| PubChem CID | 65137557 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | methyl 2-(2-methylpropylsulfanylmethyl)-1H-imidazole-5-carboxylate |
| SMILES | COC(=O)c1cnc(CSCC(C)C)[nH]1 |
| InChI | InChI=1S/C10H16N2O2S/c1-7(2)5-15-6-9-11-4-8(12-9)10(13)14-3/h4,7H,5-6H2,1-3H3,(H,11,12) |
| InChIKey | QDKAPFVBOACCRN-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |