C21H24N2O6 — CID 54052308
[2-(C-ethyl-N-prop-2-enoxycarbonimidoyl)-5,5-dimethyl-3-oxocyclohexen-1-yl] 4-nitrobenzoate (PubChem CID 54052308) has the molecular formula C21H24N2O6 and a molecular weight of 400.43 g/mol. Its IUPAC name is [2-(C-ethyl-N-prop-2-enoxycarbonimidoyl)-5,5-dimethyl-3-oxocyclohexen-1-yl] 4-nitrobenzoate.
| Compound Name | [2-(C-ethyl-N-prop-2-enoxycarbonimidoyl)-5,5-dimethyl-3-oxocyclohexen-1-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 54052308 |
| Molecular Formula | C21H24N2O6 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | [2-(C-ethyl-N-prop-2-enoxycarbonimidoyl)-5,5-dimethyl-3-oxocyclohexen-1-yl] 4-nitrobenzoate |
| SMILES | C=CCON=C(CC)C1=C(OC(=O)c2ccc([N+](=O)[O-])cc2)CC(C)(C)CC1=O |
| InChI | InChI=1S/C21H24N2O6/c1-5-11-28-22-16(6-2)19-17(24)12-21(3,4)13-18(19)29-20(25)14-7-9-15(10-8-14)23(26)27/h5,7-10H,1,6,11-13H2,2-4H3 |
| InChIKey | LTTSQDCQEJDYHO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 108.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|