C19H26N6O5 — CID 54052570
2-[(3R)-3-acetyl-3-(3-aminopropyl)-4-[(4-carbamimidoylbenzoyl)amino]-2-oxopiperazin-1-yl]acetic acid (PubChem CID 54052570) has the molecular formula C19H26N6O5 and a molecular weight of 418.45 g/mol. Its IUPAC name is 2-[(3R)-3-acetyl-3-(3-aminopropyl)-4-[(4-carbamimidoylbenzoyl)amino]-2-oxopiperazin-1-yl]acetic acid.
| Compound Name | 2-[(3R)-3-acetyl-3-(3-aminopropyl)-4-[(4-carbamimidoylbenzoyl)amino]-2-oxopiperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 54052570 |
| Molecular Formula | C19H26N6O5 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 2-[(3R)-3-acetyl-3-(3-aminopropyl)-4-[(4-carbamimidoylbenzoyl)amino]-2-oxopiperazin-1-yl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)NN2CCN(CC(=O)O)C(=O)[C@@]2(CCCN)C(C)=O)cc1 |
| InChI | InChI=1S/C19H26N6O5/c1-12(26)19(7-2-8-20)18(30)24(11-15(27)28)9-10-25(19)23-17(29)14-5-3-13(4-6-14)16(21)22/h3-6H,2,7-11,20H2,1H3,(H3,21,22)(H,23,29)(H,27,28)/t19-/m1/s1 |
| InChIKey | LTYDYYKPTRADRD-LJQANCHMSA-N |
| XLogP | -1.09 |
| TPSA | 182.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|